C19H29F3N2O2 — CID 154817919
1-methyl-N-[[(1S,5S,6R,7R)-3-(3,3,3-trifluoropropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cyclopentane-1-carboxamide (PubChem CID 154817919) has the molecular formula C19H29F3N2O2 and a molecular weight of 374.45 g/mol. Its IUPAC name is 1-methyl-N-[[(1S,5S,6R,7R)-3-(3,3,3-trifluoropropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cyclopentane-1-carboxamide.
| Compound Name | 1-methyl-N-[[(1S,5S,6R,7R)-3-(3,3,3-trifluoropropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 154817919 |
| Molecular Formula | C19H29F3N2O2 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1-methyl-N-[[(1S,5S,6R,7R)-3-(3,3,3-trifluoropropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cyclopentane-1-carboxamide |
| SMILES | CC1(C(=O)NC[C@H]2[C@H]3CN(CCC(F)(F)F)C[C@]34CC[C@H]2O4)CCCC1 |
| InChI | InChI=1S/C19H29F3N2O2/c1-17(5-2-3-6-17)16(25)23-10-13-14-11-24(9-8-19(20,21)22)12-18(14)7-4-15(13)26-18/h13-15H,2-12H2,1H3,(H,23,25)/t13-,14+,15+,18+/m0/s1 |
| InChIKey | BFCBOFVPFPDIIT-LUXYFRNMSA-N |
| XLogP | 3.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |