C16H26N4O2 — CID 154818211
(1S,3S,4S)-3-amino-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-4-hydroxy-N-methylcyclopentane-1-carboxamide (PubChem CID 154818211) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is (1S,3S,4S)-3-amino-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-4-hydroxy-N-methylcyclopentane-1-carboxamide.
| Compound Name | (1S,3S,4S)-3-amino-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-4-hydroxy-N-methylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 154818211 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (1S,3S,4S)-3-amino-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-4-hydroxy-N-methylcyclopentane-1-carboxamide |
| SMILES | CN(Cc1n[nH]c2c1CCCCC2)C(=O)[C@H]1C[C@H](N)[C@@H](O)C1 |
| InChI | InChI=1S/C16H26N4O2/c1-20(16(22)10-7-12(17)15(21)8-10)9-14-11-5-3-2-4-6-13(11)18-19-14/h10,12,15,21H,2-9,17H2,1H3,(H,18,19)/t10-,12-,15-/m0/s1 |
| InChIKey | XEILROYMGHHTHK-WBIUFABUSA-N |
| XLogP | 0.74 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |