C17H26N4O4 — CID 154819486
N-[[(1S,5S,6R,7R)-3-(2-ethoxyethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-4-methyl-1,2,5-oxadiazole-3-carboxamide (PubChem CID 154819486) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-(2-ethoxyethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-4-methyl-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-(2-ethoxyethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-4-methyl-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 154819486 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-(2-ethoxyethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-4-methyl-1,2,5-oxadiazole-3-carboxamide |
| SMILES | CCOCCN1C[C@@H]2[C@H](CNC(=O)c3nonc3C)[C@H]3CC[C@]2(C1)O3 |
| InChI | InChI=1S/C17H26N4O4/c1-3-23-7-6-21-9-13-12(14-4-5-17(13,10-21)24-14)8-18-16(22)15-11(2)19-25-20-15/h12-14H,3-10H2,1-2H3,(H,18,22)/t12-,13+,14+,17+/m0/s1 |
| InChIKey | NBCVKKHZXHEGFD-ZOMKSWQUSA-N |
| XLogP | 0.62 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|