C18H21N5 — CID 154820358
1-(1-ethylpyrrolidin-3-yl)-2-(4-imidazol-1-ylphenyl)imidazole (PubChem CID 154820358) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is 1-(1-ethylpyrrolidin-3-yl)-2-(4-imidazol-1-ylphenyl)imidazole.
| Compound Name | 1-(1-ethylpyrrolidin-3-yl)-2-(4-imidazol-1-ylphenyl)imidazole |
|---|---|
| PubChem CID | 154820358 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 1-(1-ethylpyrrolidin-3-yl)-2-(4-imidazol-1-ylphenyl)imidazole |
| SMILES | CCN1CCC(n2ccnc2-c2ccc(-n3ccnc3)cc2)C1 |
| InChI | InChI=1S/C18H21N5/c1-2-21-10-7-17(13-21)23-12-9-20-18(23)15-3-5-16(6-4-15)22-11-8-19-14-22/h3-6,8-9,11-12,14,17H,2,7,10,13H2,1H3 |
| InChIKey | AIXXALCRZLSOPO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |