C19H27FN2O — CID 154820431
1-[(1S,5S,6R,7R)-3-[(5-fluoro-2-methylphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]-N,N-dimethylmethanamine (PubChem CID 154820431) has the molecular formula C19H27FN2O and a molecular weight of 318.44 g/mol. Its IUPAC name is 1-[(1S,5S,6R,7R)-3-[(5-fluoro-2-methylphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(1S,5S,6R,7R)-3-[(5-fluoro-2-methylphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 154820431 |
| Molecular Formula | C19H27FN2O |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 1-[(1S,5S,6R,7R)-3-[(5-fluoro-2-methylphenyl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]-N,N-dimethylmethanamine |
| SMILES | Cc1ccc(F)cc1CN1C[C@@H]2[C@H](CN(C)C)[C@H]3CC[C@]2(C1)O3 |
| InChI | InChI=1S/C19H27FN2O/c1-13-4-5-15(20)8-14(13)9-22-11-17-16(10-21(2)3)18-6-7-19(17,12-22)23-18/h4-5,8,16-18H,6-7,9-12H2,1-3H3/t16-,17+,18+,19+/m0/s1 |
| InChIKey | KJRVCNMOVYUFIJ-WJFTUGDTSA-N |
| XLogP | 2.68 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |