C20H35N3O3S — CID 154821044
N,N-diethyl-2-[(1S,5S,6R,7R)-6-[[(2-propan-2-ylsulfanylacetyl)amino]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]acetamide (PubChem CID 154821044) has the molecular formula C20H35N3O3S and a molecular weight of 397.59 g/mol. Its IUPAC name is N,N-diethyl-2-[(1S,5S,6R,7R)-6-[[(2-propan-2-ylsulfanylacetyl)amino]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]acetamide.
| Compound Name | N,N-diethyl-2-[(1S,5S,6R,7R)-6-[[(2-propan-2-ylsulfanylacetyl)amino]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 154821044 |
| Molecular Formula | C20H35N3O3S |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | N,N-diethyl-2-[(1S,5S,6R,7R)-6-[[(2-propan-2-ylsulfanylacetyl)amino]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-3-yl]acetamide |
| SMILES | CCN(CC)C(=O)CN1C[C@@H]2[C@H](CNC(=O)CSC(C)C)[C@H]3CC[C@]2(C1)O3 |
| InChI | InChI=1S/C20H35N3O3S/c1-5-23(6-2)19(25)11-22-10-16-15(9-21-18(24)12-27-14(3)4)17-7-8-20(16,13-22)26-17/h14-17H,5-13H2,1-4H3,(H,21,24)/t15-,16+,17+,20+/m0/s1 |
| InChIKey | RSHFIBVQIGCFLC-TVKQPGBESA-N |
| XLogP | 1.59 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |