C13H16F3N3O2 — CID 154821077
[(4aS,6R)-4-[2-(trifluoromethyl)pyrimidin-4-yl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methanol (PubChem CID 154821077) has the molecular formula C13H16F3N3O2 and a molecular weight of 303.28 g/mol. Its IUPAC name is [(4aS,6R)-4-[2-(trifluoromethyl)pyrimidin-4-yl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methanol.
| Compound Name | [(4aS,6R)-4-[2-(trifluoromethyl)pyrimidin-4-yl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methanol |
|---|---|
| PubChem CID | 154821077 |
| Molecular Formula | C13H16F3N3O2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | [(4aS,6R)-4-[2-(trifluoromethyl)pyrimidin-4-yl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-6-yl]methanol |
| SMILES | OC[C@H]1CC2OCCN(c3ccnc(C(F)(F)F)n3)[C@H]2C1 |
| InChI | InChI=1S/C13H16F3N3O2/c14-13(15,16)12-17-2-1-11(18-12)19-3-4-21-10-6-8(7-20)5-9(10)19/h1-2,8-10,20H,3-7H2/t8-,9+,10?/m1/s1 |
| InChIKey | SSVZJIRTJHALGZ-ZDGBYWQASA-N |
| XLogP | 1.47 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |