C19H30F3N3O3 — CID 154821585
4,4,4-trifluoro-N-[[(1S,5S,6R,7R)-3-[2-(2-methylpropylamino)-2-oxoethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide (PubChem CID 154821585) has the molecular formula C19H30F3N3O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[[(1S,5S,6R,7R)-3-[2-(2-methylpropylamino)-2-oxoethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[[(1S,5S,6R,7R)-3-[2-(2-methylpropylamino)-2-oxoethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide |
|---|---|
| PubChem CID | 154821585 |
| Molecular Formula | C19H30F3N3O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 4,4,4-trifluoro-N-[[(1S,5S,6R,7R)-3-[2-(2-methylpropylamino)-2-oxoethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]butanamide |
| SMILES | CC(C)CNC(=O)CN1C[C@@H]2[C@H](CNC(=O)CCC(F)(F)F)[C@H]3CC[C@]2(C1)O3 |
| InChI | InChI=1S/C19H30F3N3O3/c1-12(2)7-23-17(27)10-25-9-14-13(15-3-5-18(14,11-25)28-15)8-24-16(26)4-6-19(20,21)22/h12-15H,3-11H2,1-2H3,(H,23,27)(H,24,26)/t13-,14+,15+,18+/m0/s1 |
| InChIKey | WSGLIAWYRJPJAE-LUXYFRNMSA-N |
| XLogP | 1.70 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |