C12H17NO — CID 15482206
2,5,7,8,9,10,10a,10b-octahydro-1H-pyrrolo[2,1-a]isoquinolin-3-one (PubChem CID 15482206) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 2,5,7,8,9,10,10a,10b-octahydro-1H-pyrrolo[2,1-a]isoquinolin-3-one.
| Compound Name | 2,5,7,8,9,10,10a,10b-octahydro-1H-pyrrolo[2,1-a]isoquinolin-3-one |
|---|---|
| PubChem CID | 15482206 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2,5,7,8,9,10,10a,10b-octahydro-1H-pyrrolo[2,1-a]isoquinolin-3-one |
| SMILES | O=C1CCC2C3CCCCC3=CCN12 |
| InChI | InChI=1S/C12H17NO/c14-12-6-5-11-10-4-2-1-3-9(10)7-8-13(11)12/h7,10-11H,1-6,8H2 |
| InChIKey | VQAHOYJNAQXKOV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|