C18H24F3N3O — CID 154822269
N,N-dimethyl-1-[(1S,5S,6R,7R)-3-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanamine (PubChem CID 154822269) has the molecular formula C18H24F3N3O and a molecular weight of 355.40 g/mol. Its IUPAC name is N,N-dimethyl-1-[(1S,5S,6R,7R)-3-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[(1S,5S,6R,7R)-3-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanamine |
|---|---|
| PubChem CID | 154822269 |
| Molecular Formula | C18H24F3N3O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N,N-dimethyl-1-[(1S,5S,6R,7R)-3-[6-methyl-4-(trifluoromethyl)-2-pyridinyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methanamine |
| SMILES | Cc1cc(C(F)(F)F)cc(N2C[C@@H]3[C@H](CN(C)C)[C@H]4CC[C@]3(C2)O4)n1 |
| InChI | InChI=1S/C18H24F3N3O/c1-11-6-12(18(19,20)21)7-16(22-11)24-9-14-13(8-23(2)3)15-4-5-17(14,10-24)25-15/h6-7,13-15H,4-5,8-10H2,1-3H3/t13-,14+,15+,17+/m0/s1 |
| InChIKey | GJZNYQUUGTVKSM-KLZNWCGWSA-N |
| XLogP | 2.95 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |