C16H22Cl2N2O3S — CID 154822472
N-[(3S,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2,6-dichlorobenzenesulfonamide (PubChem CID 154822472) has the molecular formula C16H22Cl2N2O3S and a molecular weight of 393.34 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2,6-dichlorobenzenesulfonamide.
| Compound Name | N-[(3S,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2,6-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 154822472 |
| Molecular Formula | C16H22Cl2N2O3S |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | N-[(3S,7S,8aS)-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2,6-dichlorobenzenesulfonamide |
| SMILES | CC(C)[C@H]1CN2C[C@@H](NS(=O)(=O)c3c(Cl)cccc3Cl)C[C@H]2CO1 |
| InChI | InChI=1S/C16H22Cl2N2O3S/c1-10(2)15-8-20-7-11(6-12(20)9-23-15)19-24(21,22)16-13(17)4-3-5-14(16)18/h3-5,10-12,15,19H,6-9H2,1-2H3/t11-,12-,15+/m0/s1 |
| InChIKey | USGVDQYTOQLYRU-SLEUVZQESA-N |
| XLogP | 2.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |