C26H45N3O3 — CID 154822718
(1R,2S,8S,11R,16S)-11-methyl-18-(3-methylbutanoyl)-8-propan-2-yl-7,14,18-triazatricyclo[14.3.1.02,14]icosane-6,13-dione (PubChem CID 154822718) has the molecular formula C26H45N3O3 and a molecular weight of 447.66 g/mol. Its IUPAC name is (1R,2S,8S,11R,16S)-11-methyl-18-(3-methylbutanoyl)-8-propan-2-yl-7,14,18-triazatricyclo[14.3.1.02,14]icosane-6,13-dione.
| Compound Name | (1R,2S,8S,11R,16S)-11-methyl-18-(3-methylbutanoyl)-8-propan-2-yl-7,14,18-triazatricyclo[14.3.1.02,14]icosane-6,13-dione |
|---|---|
| PubChem CID | 154822718 |
| Molecular Formula | C26H45N3O3 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.35 |
| IUPAC Name | (1R,2S,8S,11R,16S)-11-methyl-18-(3-methylbutanoyl)-8-propan-2-yl-7,14,18-triazatricyclo[14.3.1.02,14]icosane-6,13-dione |
| SMILES | CC(C)CC(=O)N1C[C@@H]2C[C@H](C1)[C@@H]1CCCC(=O)N[C@H](C(C)C)CC[C@@H](C)CC(=O)N1C2 |
| InChI | InChI=1S/C26H45N3O3/c1-17(2)11-25(31)28-14-20-13-21(16-28)23-7-6-8-24(30)27-22(18(3)4)10-9-19(5)12-26(32)29(23)15-20/h17-23H,6-16H2,1-5H3,(H,27,30)/t19-,20+,21-,22+,23+/m1/s1 |
| InChIKey | KMDWAQXOGOZJHM-LILXYRQWSA-N |
| XLogP | 3.84 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |