C19H27ClN2O4 — CID 154822893
(5aS,8aS)-7-[(3-chloro-4,5-diethoxyphenyl)methyl]-5-methyl-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one (PubChem CID 154822893) has the molecular formula C19H27ClN2O4 and a molecular weight of 382.89 g/mol. Its IUPAC name is (5aS,8aS)-7-[(3-chloro-4,5-diethoxyphenyl)methyl]-5-methyl-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one.
| Compound Name | (5aS,8aS)-7-[(3-chloro-4,5-diethoxyphenyl)methyl]-5-methyl-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one |
|---|---|
| PubChem CID | 154822893 |
| Molecular Formula | C19H27ClN2O4 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (5aS,8aS)-7-[(3-chloro-4,5-diethoxyphenyl)methyl]-5-methyl-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one |
| SMILES | CCOc1cc(CN2C[C@@H]3OCCC(=O)N(C)[C@H]3C2)cc(Cl)c1OCC |
| InChI | InChI=1S/C19H27ClN2O4/c1-4-24-16-9-13(8-14(20)19(16)25-5-2)10-22-11-15-17(12-22)26-7-6-18(23)21(15)3/h8-9,15,17H,4-7,10-12H2,1-3H3/t15-,17-/m0/s1 |
| InChIKey | NOUMOJLGZLKMSP-RDJZCZTQSA-N |
| XLogP | 2.57 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |