C21H31N5O2 — CID 154823187
N-[[(1S,5S,6R,7R)-3-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cyclopent-3-ene-1-carboxamide (PubChem CID 154823187) has the molecular formula C21H31N5O2 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cyclopent-3-ene-1-carboxamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cyclopent-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 154823187 |
| Molecular Formula | C21H31N5O2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]cyclopent-3-ene-1-carboxamide |
| SMILES | CC(C)n1cnnc1CN1C[C@@H]2[C@H](CNC(=O)C3CC=CC3)[C@H]3CC[C@]2(C1)O3 |
| InChI | InChI=1S/C21H31N5O2/c1-14(2)26-13-23-24-19(26)11-25-10-17-16(18-7-8-21(17,12-25)28-18)9-22-20(27)15-5-3-4-6-15/h3-4,13-18H,5-12H2,1-2H3,(H,22,27)/t16-,17+,18+,21+/m0/s1 |
| InChIKey | NGQFBKJDHIVUQW-XKGFGPFHSA-N |
| XLogP | 1.92 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|