C15H24N4O2 — CID 154823296
(4S,9aR)-8-(5-methoxypyrimidin-2-yl)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 154823296) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is (4S,9aR)-8-(5-methoxypyrimidin-2-yl)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | (4S,9aR)-8-(5-methoxypyrimidin-2-yl)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 154823296 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (4S,9aR)-8-(5-methoxypyrimidin-2-yl)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | CCC[C@H]1COC[C@H]2CN(c3ncc(OC)cn3)CCN12 |
| InChI | InChI=1S/C15H24N4O2/c1-3-4-12-10-21-11-13-9-18(5-6-19(12)13)15-16-7-14(20-2)8-17-15/h7-8,12-13H,3-6,9-11H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | YDSUFJMAAILIOI-QWHCGFSZSA-N |
| XLogP | 1.17 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |