About [2,3,4,5-tetraethyl-6-(hydroxymethyl)phenyl]methanol
[2,3,4,5-tetraethyl-6-(hydroxymethyl)phenyl]methanol (PubChem CID 15482392) has the molecular formula C16H26O2
and a molecular weight of 250.38 g/mol. Its IUPAC name is [2,3,4,5-tetraethyl-6-(hydroxymethyl)phenyl]methanol.
Molecular Properties
| Compound Name | [2,3,4,5-tetraethyl-6-(hydroxymethyl)phenyl]methanol |
| PubChem CID | 15482392 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | [2,3,4,5-tetraethyl-6-(hydroxymethyl)phenyl]methanol |
| SMILES | CCc1c(CC)c(CC)c(CO)c(CO)c1CC |
| InChI | InChI=1S/C16H26O2/c1-5-11-12(6-2)14(8-4)16(10-18)15(9-17)13(11)7-3/h17-18H,5-10H2,1-4H3 |
| InChIKey | UDDVFSMAJQFDQQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2,3,4,5-tetraethyl-6-(hydroxymethyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3,4,5-tetraethyl-6-(hydroxymethyl)phenyl]methanol?
The IUPAC name of [2,3,4,5-tetraethyl-6-(hydroxymethyl)phenyl]methanol (CID 15482392) is [2,3,4,5-tetraethyl-6-(hydroxymethyl)phenyl]methanol.
What is the SMILES notation for [2,3,4,5-tetraethyl-6-(hydroxymethyl)phenyl]methanol?
The canonical SMILES for [2,3,4,5-tetraethyl-6-(hydroxymethyl)phenyl]methanol is CCc1c(CC)c(CC)c(CO)c(CO)c1CC.
What is the InChIKey of [2,3,4,5-tetraethyl-6-(hydroxymethyl)phenyl]methanol?
The InChIKey is UDDVFSMAJQFDQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O2/c1-5-11-12(6-2)14(8-4)16(10-18)15(9-17)13(11)7-3/h17-18H,5-10H2,1-4H3.
What are the key properties of [2,3,4,5-tetraethyl-6-(hydroxymethyl)phenyl]methanol?
[2,3,4,5-tetraethyl-6-(hydroxymethyl)phenyl]methanol has a molecular weight of 250.38 g/mol, XLogP of 2.92, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3,4,5-tetraethyl-6-(hydroxymethyl)phenyl]methanol is sourced from PubChem (CID 15482392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).