C18H29F3N2O2 — CID 154823936
4-methyl-N-[[(1S,5S,6R,7R)-3-(3,3,3-trifluoropropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pentanamide (PubChem CID 154823936) has the molecular formula C18H29F3N2O2 and a molecular weight of 362.44 g/mol. Its IUPAC name is 4-methyl-N-[[(1S,5S,6R,7R)-3-(3,3,3-trifluoropropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pentanamide.
| Compound Name | 4-methyl-N-[[(1S,5S,6R,7R)-3-(3,3,3-trifluoropropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pentanamide |
|---|---|
| PubChem CID | 154823936 |
| Molecular Formula | C18H29F3N2O2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 4-methyl-N-[[(1S,5S,6R,7R)-3-(3,3,3-trifluoropropyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]pentanamide |
| SMILES | CC(C)CCC(=O)NC[C@H]1[C@H]2CN(CCC(F)(F)F)C[C@]23CC[C@H]1O3 |
| InChI | InChI=1S/C18H29F3N2O2/c1-12(2)3-4-16(24)22-9-13-14-10-23(8-7-18(19,20)21)11-17(14)6-5-15(13)25-17/h12-15H,3-11H2,1-2H3,(H,22,24)/t13-,14+,15+,17+/m0/s1 |
| InChIKey | DSVGKGDOTJGNRI-KLZNWCGWSA-N |
| XLogP | 2.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |