C18H24N2O3 — CID 154824404
3-methylbutyl 5-[2-(4-methoxyphenyl)ethyl]-1H-pyrazole-3-carboxylate (PubChem CID 154824404) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-methylbutyl 5-[2-(4-methoxyphenyl)ethyl]-1H-pyrazole-3-carboxylate.
| Compound Name | 3-methylbutyl 5-[2-(4-methoxyphenyl)ethyl]-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 154824404 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 3-methylbutyl 5-[2-(4-methoxyphenyl)ethyl]-1H-pyrazole-3-carboxylate |
| SMILES | COc1ccc(CCc2cc(C(=O)OCCC(C)C)n[nH]2)cc1 |
| InChI | InChI=1S/C18H24N2O3/c1-13(2)10-11-23-18(21)17-12-15(19-20-17)7-4-14-5-8-16(22-3)9-6-14/h5-6,8-9,12-13H,4,7,10-11H2,1-3H3,(H,19,20) |
| InChIKey | KQGNUZUXWRYRJI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |