C16H21N2O3- — CID 154825525
3-ethyl-2-[(2-piperidin-1-ylacetyl)amino]benzoate (PubChem CID 154825525) has the molecular formula C16H21N2O3- and a molecular weight of 289.35 g/mol. Its IUPAC name is 3-ethyl-2-[(2-piperidin-1-ylacetyl)amino]benzoate.
| Compound Name | 3-ethyl-2-[(2-piperidin-1-ylacetyl)amino]benzoate |
|---|---|
| PubChem CID | 154825525 |
| Molecular Formula | C16H21N2O3- |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 3-ethyl-2-[(2-piperidin-1-ylacetyl)amino]benzoate |
| SMILES | CCc1cccc(C(=O)[O-])c1NC(=O)CN1CCCCC1 |
| InChI | InChI=1S/C16H22N2O3/c1-2-12-7-6-8-13(16(20)21)15(12)17-14(19)11-18-9-4-3-5-10-18/h6-8H,2-5,9-11H2,1H3,(H,17,19)(H,20,21)/p-1 |
| InChIKey | YIKIMYLCGXSNNC-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |