C30H37NO6 — CID 154825559
[(1R,2R,5R,7R,11R,12S,16S)-16-benzyl-5,12-dihydroxy-5,7,13,14-tetramethyl-6,18-dioxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,13-trien-2-yl] acetate (PubChem CID 154825559) has the molecular formula C30H37NO6 and a molecular weight of 507.63 g/mol. Its IUPAC name is [(1R,2R,5R,7R,11R,12S,16S)-16-benzyl-5,12-dihydroxy-5,7,13,14-tetramethyl-6,18-dioxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,13-trien-2-yl] acetate.
| Compound Name | [(1R,2R,5R,7R,11R,12S,16S)-16-benzyl-5,12-dihydroxy-5,7,13,14-tetramethyl-6,18-dioxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,13-trien-2-yl] acetate |
|---|---|
| PubChem CID | 154825559 |
| Molecular Formula | C30H37NO6 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | [(1R,2R,5R,7R,11R,12S,16S)-16-benzyl-5,12-dihydroxy-5,7,13,14-tetramethyl-6,18-dioxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,13-trien-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C[C@@](C)(O)C(=O)[C@H](C)CC=C[C@H]2[C@H](O)C(C)=C(C)C3[C@H](Cc4ccccc4)NC(=O)[C@@]312 |
| InChI | InChI=1S/C30H37NO6/c1-17-10-9-13-22-26(33)19(3)18(2)25-23(16-21-11-7-6-8-12-21)31-28(35)30(22,25)24(37-20(4)32)14-15-29(5,36)27(17)34/h6-9,11-15,17,22-26,33,36H,10,16H2,1-5H3,(H,31,35)/t17-,22+,23+,24-,25?,26-,29-,30-/m1/s1 |
| InChIKey | NAIODHJWOHMDJX-WTQVKICTSA-N |
| XLogP | 3.06 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|