About 5-(4-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-4-(trifluoromethyl)-4H-pyridazin-3-one
5-(4-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-4-(trifluoromethyl)-4H-pyridazin-3-one (PubChem CID 154825848) has the molecular formula C18H19F3N4O2
and a molecular weight of 380.37 g/mol. Its IUPAC name is 5-(4-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-4-(trifluoromethyl)-4H-pyridazin-3-one.
Molecular Properties
| Compound Name | 5-(4-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-4-(trifluoromethyl)-4H-pyridazin-3-one |
| PubChem CID | 154825848 |
| Molecular Formula | C18H19F3N4O2 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 5-(4-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-4-(trifluoromethyl)-4H-pyridazin-3-one |
| SMILES | O=C1N=NC=C(N2Cc3cccc(OC4CCNCC4)c3C2)C1C(F)(F)F |
| InChI | InChI=1S/C18H19F3N4O2/c19-18(20,21)16-14(8-23-24-17(16)26)25-9-11-2-1-3-15(13(11)10-25)27-12-4-6-22-7-5-12/h1-3,8,12,16,22H,4-7,9-10H2 |
| InChIKey | VSKNOFRQGGUXKP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-4-(trifluoromethyl)-4H-pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-4-(trifluoromethyl)-4H-pyridazin-3-one?
The IUPAC name of 5-(4-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-4-(trifluoromethyl)-4H-pyridazin-3-one (CID 154825848) is 5-(4-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-4-(trifluoromethyl)-4H-pyridazin-3-one.
What is the SMILES notation for 5-(4-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-4-(trifluoromethyl)-4H-pyridazin-3-one?
The canonical SMILES for 5-(4-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-4-(trifluoromethyl)-4H-pyridazin-3-one is O=C1N=NC=C(N2Cc3cccc(OC4CCNCC4)c3C2)C1C(F)(F)F.
What is the InChIKey of 5-(4-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-4-(trifluoromethyl)-4H-pyridazin-3-one?
The InChIKey is VSKNOFRQGGUXKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F3N4O2/c19-18(20,21)16-14(8-23-24-17(16)26)25-9-11-2-1-3-15(13(11)10-25)27-12-4-6-22-7-5-12/h1-3,8,12,16,22H,4-7,9-10H2.
What are the key properties of 5-(4-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-4-(trifluoromethyl)-4H-pyridazin-3-one?
5-(4-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-4-(trifluoromethyl)-4H-pyridazin-3-one has a molecular weight of 380.37 g/mol, XLogP of 3.15, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-piperidin-4-yloxy-1,3-dihydroisoindol-2-yl)-4-(trifluoromethyl)-4H-pyridazin-3-one is sourced from PubChem (CID 154825848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).