About 5-[(1R)-1-methyl-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)diazinan-3-one
5-[(1R)-1-methyl-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)diazinan-3-one (PubChem CID 154825928) has the molecular formula C14H16F3N3O
and a molecular weight of 299.30 g/mol. Its IUPAC name is 5-[(1R)-1-methyl-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)diazinan-3-one.
Molecular Properties
| Compound Name | 5-[(1R)-1-methyl-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)diazinan-3-one |
| PubChem CID | 154825928 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 5-[(1R)-1-methyl-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)diazinan-3-one |
| SMILES | C[C@@H]1c2ccccc2CN1C1CNNC(=O)C1C(F)(F)F |
| InChI | InChI=1S/C14H16F3N3O/c1-8-10-5-3-2-4-9(10)7-20(8)11-6-18-19-13(21)12(11)14(15,16)17/h2-5,8,11-12,18H,6-7H2,1H3,(H,19,21)/t8-,11?,12?/m1/s1 |
| InChIKey | KVORGNWWSWJGLU-HUUUCTMMSA-N |
| XLogP | 1.74 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(1R)-1-methyl-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)diazinan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1R)-1-methyl-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)diazinan-3-one?
The IUPAC name of 5-[(1R)-1-methyl-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)diazinan-3-one (CID 154825928) is 5-[(1R)-1-methyl-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)diazinan-3-one.
What is the SMILES notation for 5-[(1R)-1-methyl-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)diazinan-3-one?
The canonical SMILES for 5-[(1R)-1-methyl-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)diazinan-3-one is C[C@@H]1c2ccccc2CN1C1CNNC(=O)C1C(F)(F)F.
What is the InChIKey of 5-[(1R)-1-methyl-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)diazinan-3-one?
The InChIKey is KVORGNWWSWJGLU-HUUUCTMMSA-N. The full InChI is InChI=1S/C14H16F3N3O/c1-8-10-5-3-2-4-9(10)7-20(8)11-6-18-19-13(21)12(11)14(15,16)17/h2-5,8,11-12,18H,6-7H2,1H3,(H,19,21)/t8-,11?,12?/m1/s1.
What are the key properties of 5-[(1R)-1-methyl-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)diazinan-3-one?
5-[(1R)-1-methyl-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)diazinan-3-one has a molecular weight of 299.30 g/mol, XLogP of 1.74, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1R)-1-methyl-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)diazinan-3-one is sourced from PubChem (CID 154825928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).