C15H15F3N4O3 — CID 154825986
5-[2-(2-methoxyethoxy)-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one (PubChem CID 154825986) has the molecular formula C15H15F3N4O3 and a molecular weight of 356.30 g/mol. Its IUPAC name is 5-[2-(2-methoxyethoxy)-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one.
| Compound Name | 5-[2-(2-methoxyethoxy)-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one |
|---|---|
| PubChem CID | 154825986 |
| Molecular Formula | C15H15F3N4O3 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 5-[2-(2-methoxyethoxy)-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one |
| SMILES | COCCOc1ccc2c(n1)CN(C1=CN=NC(=O)C1C(F)(F)F)C2 |
| InChI | InChI=1S/C15H15F3N4O3/c1-24-4-5-25-12-3-2-9-7-22(8-10(9)20-12)11-6-19-21-14(23)13(11)15(16,17)18/h2-3,6,13H,4-5,7-8H2,1H3 |
| InChIKey | QUEWKSHSUGBVBY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|