About 5-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one
5-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one (PubChem CID 154825997) has the molecular formula C14H13F3N4O
and a molecular weight of 310.28 g/mol. Its IUPAC name is 5-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one.
Molecular Properties
| Compound Name | 5-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one |
| PubChem CID | 154825997 |
| Molecular Formula | C14H13F3N4O |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 5-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one |
| SMILES | NCc1ccc2c(c1)CN(C1=CN=NC(=O)C1C(F)(F)F)C2 |
| InChI | InChI=1S/C14H13F3N4O/c15-14(16,17)12-11(5-19-20-13(12)22)21-6-9-2-1-8(4-18)3-10(9)7-21/h1-3,5,12H,4,6-7,18H2 |
| InChIKey | IKMJEVVPQWANIE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one?
The IUPAC name of 5-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one (CID 154825997) is 5-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one.
What is the SMILES notation for 5-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one?
The canonical SMILES for 5-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one is NCc1ccc2c(c1)CN(C1=CN=NC(=O)C1C(F)(F)F)C2.
What is the InChIKey of 5-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one?
The InChIKey is IKMJEVVPQWANIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F3N4O/c15-14(16,17)12-11(5-19-20-13(12)22)21-6-9-2-1-8(4-18)3-10(9)7-21/h1-3,5,12H,4,6-7,18H2.
What are the key properties of 5-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one?
5-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one has a molecular weight of 310.28 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one is sourced from PubChem (CID 154825997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).