About US10550105, Example 338
US10550105, Example 338 (PubChem CID 154826013) has the molecular formula C19H20F3N5O3
and a molecular weight of 423.40 g/mol. Its IUPAC name is 5-[4-(1-acetylpiperidin-4-yl)oxy-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one.
Molecular Properties
| Compound Name | US10550105, Example 338 |
| PubChem CID | 154826013 |
| Molecular Formula | C19H20F3N5O3 |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 5-[4-(1-acetylpiperidin-4-yl)oxy-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one |
| SMILES | CC(=O)N1CCC(CC1)OC2=C3CN(CC3=NC=C2)C4=CN=NC(=O)C4C(F)(F)F |
| InChI | InChI=1S/C19H20F3N5O3/c1-11(28)26-6-3-12(4-7-26)30-16-2-5-23-14-10-27(9-13(14)16)15-8-24-25-18(29)17(15)19(20,21)22/h2,5,8,12,17H,3-4,6-7,9-10H2,1H3 |
| InChIKey | JQLCCXVPBCLVLI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 87.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | 748 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze US10550105, Example 338 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10550105, Example 338?
The IUPAC name of US10550105, Example 338 (CID 154826013) is 5-[4-(1-acetylpiperidin-4-yl)oxy-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl]-4-(trifluoromethyl)-4H-pyridazin-3-one.
What is the SMILES notation for US10550105, Example 338?
The canonical SMILES for US10550105, Example 338 is CC(=O)N1CCC(CC1)OC2=C3CN(CC3=NC=C2)C4=CN=NC(=O)C4C(F)(F)F.
What is the InChIKey of US10550105, Example 338?
The InChIKey is JQLCCXVPBCLVLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F3N5O3/c1-11(28)26-6-3-12(4-7-26)30-16-2-5-23-14-10-27(9-13(14)16)15-8-24-25-18(29)17(15)19(20,21)22/h2,5,8,12,17H,3-4,6-7,9-10H2,1H3.
What are the key properties of US10550105, Example 338?
US10550105, Example 338 has a molecular weight of 423.40 g/mol, XLogP of 1.50, 3 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for US10550105, Example 338 is sourced from PubChem (CID 154826013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).