C23H32N4OS — CID 154826824
4-[[4-[(8-methyl-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)methylsulfanyl]piperidin-1-yl]methyl]benzonitrile (PubChem CID 154826824) has the molecular formula C23H32N4OS and a molecular weight of 412.60 g/mol. Its IUPAC name is 4-[[4-[(8-methyl-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)methylsulfanyl]piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[(8-methyl-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)methylsulfanyl]piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 154826824 |
| Molecular Formula | C23H32N4OS |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 4-[[4-[(8-methyl-4-oxo-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-2-yl)methylsulfanyl]piperidin-1-yl]methyl]benzonitrile |
| SMILES | CC1CCCC2C(=O)NC(CSC3CCN(Cc4ccc(C#N)cc4)CC3)NC12 |
| InChI | InChI=1S/C23H32N4OS/c1-16-3-2-4-20-22(16)25-21(26-23(20)28)15-29-19-9-11-27(12-10-19)14-18-7-5-17(13-24)6-8-18/h5-8,16,19-22,25H,2-4,9-12,14-15H2,1H3,(H,26,28) |
| InChIKey | RZNMXLQECBEQLZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |