C23H35N3OS — CID 154826830
8-methyl-2-[[1-(2-phenylethyl)piperidin-4-yl]sulfanylmethyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one (PubChem CID 154826830) has the molecular formula C23H35N3OS and a molecular weight of 401.62 g/mol. Its IUPAC name is 8-methyl-2-[[1-(2-phenylethyl)piperidin-4-yl]sulfanylmethyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one.
| Compound Name | 8-methyl-2-[[1-(2-phenylethyl)piperidin-4-yl]sulfanylmethyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 154826830 |
| Molecular Formula | C23H35N3OS |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 8-methyl-2-[[1-(2-phenylethyl)piperidin-4-yl]sulfanylmethyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one |
| SMILES | CC1CCCC2C(=O)NC(CSC3CCN(CCc4ccccc4)CC3)NC12 |
| InChI | InChI=1S/C23H35N3OS/c1-17-6-5-9-20-22(17)24-21(25-23(20)27)16-28-19-11-14-26(15-12-19)13-10-18-7-3-2-4-8-18/h2-4,7-8,17,19-22,24H,5-6,9-16H2,1H3,(H,25,27) |
| InChIKey | AUWMUBWHJYCITB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |