C24H15BrN2O4 — CID 15482883
(1R,5S,7R,11R)-14-bromo-4,8-diphenyl-2,10-dioxa-3,9-diazatetracyclo[11.3.0.01,5.07,11]hexadeca-3,8,12,14-tetraene-6,16-dione (PubChem CID 15482883) has the molecular formula C24H15BrN2O4 and a molecular weight of 475.30 g/mol. Its IUPAC name is (1R,5S,7R,11R)-14-bromo-4,8-diphenyl-2,10-dioxa-3,9-diazatetracyclo[11.3.0.01,5.07,11]hexadeca-3,8,12,14-tetraene-6,16-dione.
| Compound Name | (1R,5S,7R,11R)-14-bromo-4,8-diphenyl-2,10-dioxa-3,9-diazatetracyclo[11.3.0.01,5.07,11]hexadeca-3,8,12,14-tetraene-6,16-dione |
|---|---|
| PubChem CID | 15482883 |
| Molecular Formula | C24H15BrN2O4 |
| Molecular Weight | 475.30 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | (1R,5S,7R,11R)-14-bromo-4,8-diphenyl-2,10-dioxa-3,9-diazatetracyclo[11.3.0.01,5.07,11]hexadeca-3,8,12,14-tetraene-6,16-dione |
| SMILES | O=C1[C@@H]2C(c3ccccc3)=NO[C@@H]2C=C2C(Br)=CC(=O)[C@]23ON=C(c2ccccc2)[C@H]13 |
| InChI | InChI=1S/C24H15BrN2O4/c25-16-12-18(28)24-15(16)11-17-19(21(26-30-17)13-7-3-1-4-8-13)23(29)20(24)22(27-31-24)14-9-5-2-6-10-14/h1-12,17,19-20H/t17-,19+,20-,24-/m1/s1 |
| InChIKey | JBGROQLOLUOGAJ-SSYAZSBWSA-N |
| XLogP | 3.57 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |