C17H23N3S — CID 154829009
5-[(4-benzylpiperazin-1-yl)methyl]-2,4-dimethyl-1,3-thiazole (PubChem CID 154829009) has the molecular formula C17H23N3S and a molecular weight of 301.46 g/mol. Its IUPAC name is 5-[(4-benzylpiperazin-1-yl)methyl]-2,4-dimethyl-1,3-thiazole.
| Compound Name | 5-[(4-benzylpiperazin-1-yl)methyl]-2,4-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 154829009 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 5-[(4-benzylpiperazin-1-yl)methyl]-2,4-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(C)c(CN2CCN(Cc3ccccc3)CC2)s1 |
| InChI | InChI=1S/C17H23N3S/c1-14-17(21-15(2)18-14)13-20-10-8-19(9-11-20)12-16-6-4-3-5-7-16/h3-7H,8-13H2,1-2H3 |
| InChIKey | TVFFFNBQBUDGEL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |