C16H17FN4 — CID 154829521
1-(5-fluoro-2-pyridinyl)-5-pyridin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 154829521) has the molecular formula C16H17FN4 and a molecular weight of 284.34 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-5-pyridin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-5-pyridin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 154829521 |
| Molecular Formula | C16H17FN4 |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-5-pyridin-2-yl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | Fc1ccc(N2CCC3CN(c4ccccn4)CC32)nc1 |
| InChI | InChI=1S/C16H17FN4/c17-13-4-5-16(19-9-13)21-8-6-12-10-20(11-14(12)21)15-3-1-2-7-18-15/h1-5,7,9,12,14H,6,8,10-11H2 |
| InChIKey | VYZSQRJLHUGAKO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |