C16H20N4S — CID 154829542
2-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)azetidin-1-yl]-[1,3]thiazolo[4,5-c]pyridine (PubChem CID 154829542) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is 2-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)azetidin-1-yl]-[1,3]thiazolo[4,5-c]pyridine.
| Compound Name | 2-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)azetidin-1-yl]-[1,3]thiazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 154829542 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)azetidin-1-yl]-[1,3]thiazolo[4,5-c]pyridine |
| SMILES | c1cc2sc(N3CC(N4CC5CCCC5C4)C3)nc2cn1 |
| InChI | InChI=1S/C16H20N4S/c1-2-11-7-19(8-12(11)3-1)13-9-20(10-13)16-18-14-6-17-5-4-15(14)21-16/h4-6,11-13H,1-3,7-10H2 |
| InChIKey | NGVIOKFZAIRFRI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |