C16H18N8O — CID 154829998
1-methyl-3-[4-(6-pyrazol-1-ylpyrimidin-4-yl)piperazin-1-yl]pyrazin-2-one (PubChem CID 154829998) has the molecular formula C16H18N8O and a molecular weight of 338.38 g/mol. Its IUPAC name is 1-methyl-3-[4-(6-pyrazol-1-ylpyrimidin-4-yl)piperazin-1-yl]pyrazin-2-one.
| Compound Name | 1-methyl-3-[4-(6-pyrazol-1-ylpyrimidin-4-yl)piperazin-1-yl]pyrazin-2-one |
|---|---|
| PubChem CID | 154829998 |
| Molecular Formula | C16H18N8O |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-methyl-3-[4-(6-pyrazol-1-ylpyrimidin-4-yl)piperazin-1-yl]pyrazin-2-one |
| SMILES | Cn1ccnc(N2CCN(c3cc(-n4cccn4)ncn3)CC2)c1=O |
| InChI | InChI=1S/C16H18N8O/c1-21-6-4-17-15(16(21)25)23-9-7-22(8-10-23)13-11-14(19-12-18-13)24-5-2-3-20-24/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | SXLVAAKPBCRURR-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 84.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |