About 2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-5-fluoro-4-propan-2-yl-1H-pyrimidin-6-one
2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-5-fluoro-4-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 154830593) has the molecular formula C17H27FN4O2
and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-5-fluoro-4-propan-2-yl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-5-fluoro-4-propan-2-yl-1H-pyrimidin-6-one |
| PubChem CID | 154830593 |
| Molecular Formula | C17H27FN4O2 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-5-fluoro-4-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)c1nc(N2CCN(C(=O)CC(C)(C)C)CC2)[nH]c(=O)c1F |
| InChI | InChI=1S/C17H27FN4O2/c1-11(2)14-13(18)15(24)20-16(19-14)22-8-6-21(7-9-22)12(23)10-17(3,4)5/h11H,6-10H2,1-5H3,(H,19,20,24) |
| InChIKey | VQZXUOLLECZMGB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-5-fluoro-4-propan-2-yl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-5-fluoro-4-propan-2-yl-1H-pyrimidin-6-one?
The IUPAC name of 2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-5-fluoro-4-propan-2-yl-1H-pyrimidin-6-one (CID 154830593) is 2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-5-fluoro-4-propan-2-yl-1H-pyrimidin-6-one.
What is the SMILES notation for 2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-5-fluoro-4-propan-2-yl-1H-pyrimidin-6-one?
The canonical SMILES for 2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-5-fluoro-4-propan-2-yl-1H-pyrimidin-6-one is CC(C)c1nc(N2CCN(C(=O)CC(C)(C)C)CC2)[nH]c(=O)c1F.
What is the InChIKey of 2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-5-fluoro-4-propan-2-yl-1H-pyrimidin-6-one?
The InChIKey is VQZXUOLLECZMGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27FN4O2/c1-11(2)14-13(18)15(24)20-16(19-14)22-8-6-21(7-9-22)12(23)10-17(3,4)5/h11H,6-10H2,1-5H3,(H,19,20,24).
What are the key properties of 2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-5-fluoro-4-propan-2-yl-1H-pyrimidin-6-one?
2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-5-fluoro-4-propan-2-yl-1H-pyrimidin-6-one has a molecular weight of 338.43 g/mol, XLogP of 2.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-5-fluoro-4-propan-2-yl-1H-pyrimidin-6-one is sourced from PubChem (CID 154830593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).