About tert-butyl 4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazine-1-carboxylate
tert-butyl 4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazine-1-carboxylate (PubChem CID 154830998) has the molecular formula C16H26N4O2S
and a molecular weight of 338.48 g/mol. Its IUPAC name is tert-butyl 4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazine-1-carboxylate |
| PubChem CID | 154830998 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | tert-butyl 4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazine-1-carboxylate |
| SMILES | CSc1nc(C)c(C)c(N2CCN(C(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C16H26N4O2S/c1-11-12(2)17-14(23-6)18-13(11)19-7-9-20(10-8-19)15(21)22-16(3,4)5/h7-10H2,1-6H3 |
| InChIKey | PSAVWLTZHVUFGN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazine-1-carboxylate (CID 154830998) is tert-butyl 4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazine-1-carboxylate is CSc1nc(C)c(C)c(N2CCN(C(=O)OC(C)(C)C)CC2)n1.
What is the InChIKey of tert-butyl 4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazine-1-carboxylate?
The InChIKey is PSAVWLTZHVUFGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O2S/c1-11-12(2)17-14(23-6)18-13(11)19-7-9-20(10-8-19)15(21)22-16(3,4)5/h7-10H2,1-6H3.
What are the key properties of tert-butyl 4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazine-1-carboxylate?
tert-butyl 4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazine-1-carboxylate has a molecular weight of 338.48 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)piperazine-1-carboxylate is sourced from PubChem (CID 154830998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).