7-bromo-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonyl fluoride

C9H7BrFNO3S — CID 154832119

IUPAC7-bromo-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonyl fluoride
SMILESO=C1CCc2cc(S(=O)(=O)F)c(Br)cc2N1
InChIInChI=1S/C9H7BrFNO3S/c10-6-4-7-5(1-2-9(13)12-7)3-8(6)16(11,14)15/h3-4H,1-2H2,(H,12,13)
InChIKeyAXXRMVIWUFKSNA-UHFFFAOYSA-N
MW308.13 g/mol
LogP1.99
Rot. Bonds1

About 7-bromo-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonyl fluoride

7-bromo-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonyl fluoride (PubChem CID 154832119) has the molecular formula C9H7BrFNO3S and a molecular weight of 308.13 g/mol. Its IUPAC name is 7-bromo-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonyl fluoride.

Molecular Properties

Compound Name7-bromo-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonyl fluoride
PubChem CID154832119
Molecular FormulaC9H7BrFNO3S
Molecular Weight308.13 g/mol
Exact Mass306.93
IUPAC Name7-bromo-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonyl fluoride
SMILESO=C1CCc2cc(S(=O)(=O)F)c(Br)cc2N1
InChIInChI=1S/C9H7BrFNO3S/c10-6-4-7-5(1-2-9(13)12-7)3-8(6)16(11,14)15/h3-4H,1-2H2,(H,12,13)
InChIKeyAXXRMVIWUFKSNA-UHFFFAOYSA-N
XLogP1.99
TPSA63.24 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.13
LogP ≤ 51.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 7-bromo-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-bromo-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonyl fluoride?
The IUPAC name of 7-bromo-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonyl fluoride (CID 154832119) is 7-bromo-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonyl fluoride.
What is the SMILES notation for 7-bromo-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonyl fluoride?
The canonical SMILES for 7-bromo-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonyl fluoride is O=C1CCc2cc(S(=O)(=O)F)c(Br)cc2N1.
What is the InChIKey of 7-bromo-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonyl fluoride?
The InChIKey is AXXRMVIWUFKSNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrFNO3S/c10-6-4-7-5(1-2-9(13)12-7)3-8(6)16(11,14)15/h3-4H,1-2H2,(H,12,13).
What are the key properties of 7-bromo-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonyl fluoride?
7-bromo-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonyl fluoride has a molecular weight of 308.13 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonyl fluoride is sourced from PubChem (CID 154832119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).