About 6-amino-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrobromide
6-amino-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrobromide (PubChem CID 154832824) has the molecular formula C6H7BrN4O
and a molecular weight of 231.05 g/mol. Its IUPAC name is 6-amino-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrobromide.
Molecular Properties
| Compound Name | 6-amino-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrobromide |
| PubChem CID | 154832824 |
| Molecular Formula | C6H7BrN4O |
| Molecular Weight | 231.05 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | 6-amino-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrobromide |
| SMILES | Br.Nc1cnc2cc[nH]n2c1=O |
| InChI | InChI=1S/C6H6N4O.BrH/c7-4-3-8-5-1-2-9-10(5)6(4)11;/h1-3,9H,7H2;1H |
| InChIKey | FWSIECFGOWYELK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.05 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrobromide?
The IUPAC name of 6-amino-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrobromide (CID 154832824) is 6-amino-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrobromide.
What is the SMILES notation for 6-amino-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrobromide?
The canonical SMILES for 6-amino-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrobromide is Br.Nc1cnc2cc[nH]n2c1=O.
What is the InChIKey of 6-amino-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrobromide?
The InChIKey is FWSIECFGOWYELK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O.BrH/c7-4-3-8-5-1-2-9-10(5)6(4)11;/h1-3,9H,7H2;1H.
What are the key properties of 6-amino-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrobromide?
6-amino-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrobromide has a molecular weight of 231.05 g/mol, XLogP of 0.18, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1H-pyrazolo[1,5-a]pyrimidin-7-one;hydrobromide is sourced from PubChem (CID 154832824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).