About 3-cyclohexylmorpholine;hydrochloride
3-cyclohexylmorpholine;hydrochloride (PubChem CID 154832834) has the molecular formula C10H20ClNO
and a molecular weight of 205.73 g/mol. Its IUPAC name is 3-cyclohexylmorpholine;hydrochloride.
Molecular Properties
| Compound Name | 3-cyclohexylmorpholine;hydrochloride |
| PubChem CID | 154832834 |
| Molecular Formula | C10H20ClNO |
| Molecular Weight | 205.73 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 3-cyclohexylmorpholine;hydrochloride |
| SMILES | C1CCC(C2COCCN2)CC1.Cl |
| InChI | InChI=1S/C10H19NO.ClH/c1-2-4-9(5-3-1)10-8-12-7-6-11-10;/h9-11H,1-8H2;1H |
| InChIKey | GUXMYHAGENMJJD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.73 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclohexylmorpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylmorpholine;hydrochloride?
The IUPAC name of 3-cyclohexylmorpholine;hydrochloride (CID 154832834) is 3-cyclohexylmorpholine;hydrochloride.
What is the SMILES notation for 3-cyclohexylmorpholine;hydrochloride?
The canonical SMILES for 3-cyclohexylmorpholine;hydrochloride is C1CCC(C2COCCN2)CC1.Cl.
What is the InChIKey of 3-cyclohexylmorpholine;hydrochloride?
The InChIKey is GUXMYHAGENMJJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO.ClH/c1-2-4-9(5-3-1)10-8-12-7-6-11-10;/h9-11H,1-8H2;1H.
What are the key properties of 3-cyclohexylmorpholine;hydrochloride?
3-cyclohexylmorpholine;hydrochloride has a molecular weight of 205.73 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylmorpholine;hydrochloride is sourced from PubChem (CID 154832834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).