About 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine;hydrochloride
2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine;hydrochloride (PubChem CID 154832860) has the molecular formula C8H12ClF3N2S
and a molecular weight of 260.71 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine;hydrochloride |
| PubChem CID | 154832860 |
| Molecular Formula | C8H12ClF3N2S |
| Molecular Weight | 260.71 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine;hydrochloride |
| SMILES | CCC(C)(N)c1nc(C(F)(F)F)cs1.Cl |
| InChI | InChI=1S/C8H11F3N2S.ClH/c1-3-7(2,12)6-13-5(4-14-6)8(9,10)11;/h4H,3,12H2,1-2H3;1H |
| InChIKey | RBQQVDNVXIQYOE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.71 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine;hydrochloride?
The IUPAC name of 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine;hydrochloride (CID 154832860) is 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine;hydrochloride.
What is the SMILES notation for 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine;hydrochloride?
The canonical SMILES for 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine;hydrochloride is CCC(C)(N)c1nc(C(F)(F)F)cs1.Cl.
What is the InChIKey of 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine;hydrochloride?
The InChIKey is RBQQVDNVXIQYOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3N2S.ClH/c1-3-7(2,12)6-13-5(4-14-6)8(9,10)11;/h4H,3,12H2,1-2H3;1H.
What are the key properties of 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine;hydrochloride?
2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine;hydrochloride has a molecular weight of 260.71 g/mol, XLogP of 3.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butan-2-amine;hydrochloride is sourced from PubChem (CID 154832860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).