About 4-[(4-piperazin-1-ylphenoxy)methyl]-1,3-thiazole;trihydrochloride
4-[(4-piperazin-1-ylphenoxy)methyl]-1,3-thiazole;trihydrochloride (PubChem CID 154832946) has the molecular formula C14H20Cl3N3OS
and a molecular weight of 384.76 g/mol. Its IUPAC name is 4-[(4-piperazin-1-ylphenoxy)methyl]-1,3-thiazole;trihydrochloride.
Molecular Properties
| Compound Name | 4-[(4-piperazin-1-ylphenoxy)methyl]-1,3-thiazole;trihydrochloride |
| PubChem CID | 154832946 |
| Molecular Formula | C14H20Cl3N3OS |
| Molecular Weight | 384.76 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 4-[(4-piperazin-1-ylphenoxy)methyl]-1,3-thiazole;trihydrochloride |
| SMILES | Cl.Cl.Cl.c1nc(COc2ccc(N3CCNCC3)cc2)cs1 |
| InChI | InChI=1S/C14H17N3OS.3ClH/c1-3-14(18-9-12-10-19-11-16-12)4-2-13(1)17-7-5-15-6-8-17;;;/h1-4,10-11,15H,5-9H2;3*1H |
| InChIKey | UIFCSUIYFYLVPM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.76 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-piperazin-1-ylphenoxy)methyl]-1,3-thiazole;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-piperazin-1-ylphenoxy)methyl]-1,3-thiazole;trihydrochloride?
The IUPAC name of 4-[(4-piperazin-1-ylphenoxy)methyl]-1,3-thiazole;trihydrochloride (CID 154832946) is 4-[(4-piperazin-1-ylphenoxy)methyl]-1,3-thiazole;trihydrochloride.
What is the SMILES notation for 4-[(4-piperazin-1-ylphenoxy)methyl]-1,3-thiazole;trihydrochloride?
The canonical SMILES for 4-[(4-piperazin-1-ylphenoxy)methyl]-1,3-thiazole;trihydrochloride is Cl.Cl.Cl.c1nc(COc2ccc(N3CCNCC3)cc2)cs1.
What is the InChIKey of 4-[(4-piperazin-1-ylphenoxy)methyl]-1,3-thiazole;trihydrochloride?
The InChIKey is UIFCSUIYFYLVPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3OS.3ClH/c1-3-14(18-9-12-10-19-11-16-12)4-2-13(1)17-7-5-15-6-8-17;;;/h1-4,10-11,15H,5-9H2;3*1H.
What are the key properties of 4-[(4-piperazin-1-ylphenoxy)methyl]-1,3-thiazole;trihydrochloride?
4-[(4-piperazin-1-ylphenoxy)methyl]-1,3-thiazole;trihydrochloride has a molecular weight of 384.76 g/mol, XLogP of 3.40, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-piperazin-1-ylphenoxy)methyl]-1,3-thiazole;trihydrochloride is sourced from PubChem (CID 154832946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).