C15H20ClN3O2 — CID 154834758
3-chloro-4-ethoxy-N-[[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methyl]aniline (PubChem CID 154834758) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-N-[[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methyl]aniline.
| Compound Name | 3-chloro-4-ethoxy-N-[[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methyl]aniline |
|---|---|
| PubChem CID | 154834758 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-chloro-4-ethoxy-N-[[3-(2-methylpropyl)-1,2,4-oxadiazol-5-yl]methyl]aniline |
| SMILES | CCOc1ccc(NCc2nc(CC(C)C)no2)cc1Cl |
| InChI | InChI=1S/C15H20ClN3O2/c1-4-20-13-6-5-11(8-12(13)16)17-9-15-18-14(19-21-15)7-10(2)3/h5-6,8,10,17H,4,7,9H2,1-3H3 |
| InChIKey | WACKVTJAPJTOIY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|