C24H18N4O4 — CID 154834860
1-oxo-3-phenyl-N'-(3-phenyl-1,2,4-oxadiazol-5-yl)-3,4-dihydroisochromene-6-carbohydrazide (PubChem CID 154834860) has the molecular formula C24H18N4O4 and a molecular weight of 426.43 g/mol. Its IUPAC name is 1-oxo-3-phenyl-N'-(3-phenyl-1,2,4-oxadiazol-5-yl)-3,4-dihydroisochromene-6-carbohydrazide.
| Compound Name | 1-oxo-3-phenyl-N'-(3-phenyl-1,2,4-oxadiazol-5-yl)-3,4-dihydroisochromene-6-carbohydrazide |
|---|---|
| PubChem CID | 154834860 |
| Molecular Formula | C24H18N4O4 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 1-oxo-3-phenyl-N'-(3-phenyl-1,2,4-oxadiazol-5-yl)-3,4-dihydroisochromene-6-carbohydrazide |
| SMILES | O=C(NNc1nc(-c2ccccc2)no1)c1ccc2c(c1)CC(c1ccccc1)OC2=O |
| InChI | InChI=1S/C24H18N4O4/c29-22(26-27-24-25-21(28-32-24)16-9-5-2-6-10-16)17-11-12-19-18(13-17)14-20(31-23(19)30)15-7-3-1-4-8-15/h1-13,20H,14H2,(H,26,29)(H,25,27,28) |
| InChIKey | BCUIIXZHGKFYBL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|