C18H22F3N9O — CID 154834996
N-[1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethyl]-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxamide (PubChem CID 154834996) has the molecular formula C18H22F3N9O and a molecular weight of 437.43 g/mol. Its IUPAC name is N-[1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethyl]-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxamide.
| Compound Name | N-[1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethyl]-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 154834996 |
| Molecular Formula | C18H22F3N9O |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-[1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethyl]-1-[3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidine-4-carboxamide |
| SMILES | CCc1nc(C(C)NC(=O)C2CCN(c3ccc4nnc(C(F)(F)F)n4n3)CC2)n[nH]1 |
| InChI | InChI=1S/C18H22F3N9O/c1-3-12-23-15(26-24-12)10(2)22-16(31)11-6-8-29(9-7-11)14-5-4-13-25-27-17(18(19,20)21)30(13)28-14/h4-5,10-11H,3,6-9H2,1-2H3,(H,22,31)(H,23,24,26) |
| InChIKey | XMHUALWFQGKFNV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |