C25H26N6O — CID 154835068
1H-indol-2-yl-[4-(3-pyrrolidin-1-ylquinoxalin-2-yl)piperazin-1-yl]methanone (PubChem CID 154835068) has the molecular formula C25H26N6O and a molecular weight of 426.52 g/mol. Its IUPAC name is 1H-indol-2-yl-[4-(3-pyrrolidin-1-ylquinoxalin-2-yl)piperazin-1-yl]methanone.
| Compound Name | 1H-indol-2-yl-[4-(3-pyrrolidin-1-ylquinoxalin-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 154835068 |
| Molecular Formula | C25H26N6O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 1H-indol-2-yl-[4-(3-pyrrolidin-1-ylquinoxalin-2-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc2ccccc2[nH]1)N1CCN(c2nc3ccccc3nc2N2CCCC2)CC1 |
| InChI | InChI=1S/C25H26N6O/c32-25(22-17-18-7-1-2-8-19(18)26-22)31-15-13-30(14-16-31)24-23(29-11-5-6-12-29)27-20-9-3-4-10-21(20)28-24/h1-4,7-10,17,26H,5-6,11-16H2 |
| InChIKey | OQUHHHYKOAPLEY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |