C20H38O3Si — CID 15483580
(5S,6S)-6-cyclohexyl-3-hexyl-5-(methoxymethoxy)-2,2-dimethyl-5,6-dihydrooxasiline (PubChem CID 15483580) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is (5S,6S)-6-cyclohexyl-3-hexyl-5-(methoxymethoxy)-2,2-dimethyl-5,6-dihydrooxasiline.
| Compound Name | (5S,6S)-6-cyclohexyl-3-hexyl-5-(methoxymethoxy)-2,2-dimethyl-5,6-dihydrooxasiline |
|---|---|
| PubChem CID | 15483580 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (5S,6S)-6-cyclohexyl-3-hexyl-5-(methoxymethoxy)-2,2-dimethyl-5,6-dihydrooxasiline |
| SMILES | CCCCCCC1=C[C@H](OCOC)[C@H](C2CCCCC2)O[Si]1(C)C |
| InChI | InChI=1S/C20H38O3Si/c1-5-6-7-11-14-18-15-19(22-16-21-2)20(23-24(18,3)4)17-12-9-8-10-13-17/h15,17,19-20H,5-14,16H2,1-4H3/t19-,20-/m0/s1 |
| InChIKey | DIIWOVGYRHHJDC-PMACEKPBSA-N |
| XLogP | 5.60 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|