C23H29N5O2 — CID 154836117
2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethylamino)cycloheptyl]isoindole-1,3-dione (PubChem CID 154836117) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethylamino)cycloheptyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethylamino)cycloheptyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 154836117 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethylamino)cycloheptyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C1CCCCC(NCc2nnc3n2CCCCC3)C1 |
| InChI | InChI=1S/C23H29N5O2/c29-22-18-10-5-6-11-19(18)23(30)28(22)17-9-4-3-8-16(14-17)24-15-21-26-25-20-12-2-1-7-13-27(20)21/h5-6,10-11,16-17,24H,1-4,7-9,12-15H2 |
| InChIKey | KOGSQAMXAGJWMJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|