C20H16FN5O3S — CID 154836625
(5,5-dioxo-4H-[1,2,4]triazolo[5,1-c][1,2,4]benzothiadiazin-7-yl)-(4-fluorospiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone (PubChem CID 154836625) has the molecular formula C20H16FN5O3S and a molecular weight of 425.45 g/mol. Its IUPAC name is (5,5-dioxo-4H-[1,2,4]triazolo[5,1-c][1,2,4]benzothiadiazin-7-yl)-(4-fluorospiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone.
| Compound Name | (5,5-dioxo-4H-[1,2,4]triazolo[5,1-c][1,2,4]benzothiadiazin-7-yl)-(4-fluorospiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone |
|---|---|
| PubChem CID | 154836625 |
| Molecular Formula | C20H16FN5O3S |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | (5,5-dioxo-4H-[1,2,4]triazolo[5,1-c][1,2,4]benzothiadiazin-7-yl)-(4-fluorospiro[2H-indole-3,1'-cyclobutane]-1-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)S(=O)(=O)Nc1ncnn1-2)N1CC2(CCC2)c2c(F)cccc21 |
| InChI | InChI=1S/C20H16FN5O3S/c21-13-3-1-4-15-17(13)20(7-2-8-20)10-25(15)18(27)12-5-6-14-16(9-12)30(28,29)24-19-22-11-23-26(14)19/h1,3-6,9,11H,2,7-8,10H2,(H,22,23,24) |
| InChIKey | MXZDYRVVFAQKPF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |