About 1-(5-methoxy-1,3-thiazol-2-yl)-3-[1-(oxolan-3-yl)ethyl]urea
1-(5-methoxy-1,3-thiazol-2-yl)-3-[1-(oxolan-3-yl)ethyl]urea (PubChem CID 154836734) has the molecular formula C11H17N3O3S
and a molecular weight of 271.34 g/mol. Its IUPAC name is 1-(5-methoxy-1,3-thiazol-2-yl)-3-[1-(oxolan-3-yl)ethyl]urea.
Molecular Properties
| Compound Name | 1-(5-methoxy-1,3-thiazol-2-yl)-3-[1-(oxolan-3-yl)ethyl]urea |
| PubChem CID | 154836734 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-(5-methoxy-1,3-thiazol-2-yl)-3-[1-(oxolan-3-yl)ethyl]urea |
| SMILES | COc1cnc(NC(=O)NC(C)C2CCOC2)s1 |
| InChI | InChI=1S/C11H17N3O3S/c1-7(8-3-4-17-6-8)13-10(15)14-11-12-5-9(16-2)18-11/h5,7-8H,3-4,6H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | BXXXTJPPARISSZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(5-methoxy-1,3-thiazol-2-yl)-3-[1-(oxolan-3-yl)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methoxy-1,3-thiazol-2-yl)-3-[1-(oxolan-3-yl)ethyl]urea?
The IUPAC name of 1-(5-methoxy-1,3-thiazol-2-yl)-3-[1-(oxolan-3-yl)ethyl]urea (CID 154836734) is 1-(5-methoxy-1,3-thiazol-2-yl)-3-[1-(oxolan-3-yl)ethyl]urea.
What is the SMILES notation for 1-(5-methoxy-1,3-thiazol-2-yl)-3-[1-(oxolan-3-yl)ethyl]urea?
The canonical SMILES for 1-(5-methoxy-1,3-thiazol-2-yl)-3-[1-(oxolan-3-yl)ethyl]urea is COc1cnc(NC(=O)NC(C)C2CCOC2)s1.
What is the InChIKey of 1-(5-methoxy-1,3-thiazol-2-yl)-3-[1-(oxolan-3-yl)ethyl]urea?
The InChIKey is BXXXTJPPARISSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O3S/c1-7(8-3-4-17-6-8)13-10(15)14-11-12-5-9(16-2)18-11/h5,7-8H,3-4,6H2,1-2H3,(H2,12,13,14,15).
What are the key properties of 1-(5-methoxy-1,3-thiazol-2-yl)-3-[1-(oxolan-3-yl)ethyl]urea?
1-(5-methoxy-1,3-thiazol-2-yl)-3-[1-(oxolan-3-yl)ethyl]urea has a molecular weight of 271.34 g/mol, XLogP of 1.70, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methoxy-1,3-thiazol-2-yl)-3-[1-(oxolan-3-yl)ethyl]urea is sourced from PubChem (CID 154836734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).