C16H16F6N4O3 — CID 154837035
1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4,5-dimethyl-1H-pyrazol-3-yl)urea (PubChem CID 154837035) has the molecular formula C16H16F6N4O3 and a molecular weight of 426.32 g/mol. Its IUPAC name is 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4,5-dimethyl-1H-pyrazol-3-yl)urea.
| Compound Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4,5-dimethyl-1H-pyrazol-3-yl)urea |
|---|---|
| PubChem CID | 154837035 |
| Molecular Formula | C16H16F6N4O3 |
| Molecular Weight | 426.32 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 1-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-(4,5-dimethyl-1H-pyrazol-3-yl)urea |
| SMILES | Cc1[nH]nc(NC(=O)Nc2cc(OCC(F)(F)F)cc(OCC(F)(F)F)c2)c1C |
| InChI | InChI=1S/C16H16F6N4O3/c1-8-9(2)25-26-13(8)24-14(27)23-10-3-11(28-6-15(17,18)19)5-12(4-10)29-7-16(20,21)22/h3-5H,6-7H2,1-2H3,(H3,23,24,25,26,27) |
| InChIKey | IIDXOKBETGQBGA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |