C14H18N6O2 — CID 154837315
1-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-(4,5,6,7-tetrahydro-1H-indazol-7-yl)urea (PubChem CID 154837315) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 1-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-(4,5,6,7-tetrahydro-1H-indazol-7-yl)urea.
| Compound Name | 1-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-(4,5,6,7-tetrahydro-1H-indazol-7-yl)urea |
|---|---|
| PubChem CID | 154837315 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-(4,5,6,7-tetrahydro-1H-indazol-7-yl)urea |
| SMILES | O=C(NCc1nnc(C2CC2)o1)NC1CCCc2cn[nH]c21 |
| InChI | InChI=1S/C14H18N6O2/c21-14(15-7-11-18-20-13(22-11)8-4-5-8)17-10-3-1-2-9-6-16-19-12(9)10/h6,8,10H,1-5,7H2,(H,16,19)(H2,15,17,21) |
| InChIKey | CDBZKJIGPCXJCJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |