C26H33N3O3 — CID 154838011
N'-[(1R)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]-N-[[2-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]oxamide (PubChem CID 154838011) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is N'-[(1R)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]-N-[[2-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]oxamide.
| Compound Name | N'-[(1R)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]-N-[[2-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]oxamide |
|---|---|
| PubChem CID | 154838011 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | N'-[(1R)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]-N-[[2-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]oxamide |
| SMILES | C[C@@H](NC(=O)C(=O)NCc1ccccc1CN1CCC(O)CC1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C26H33N3O3/c1-18(20-10-9-19-7-4-8-21(19)15-20)28-26(32)25(31)27-16-22-5-2-3-6-23(22)17-29-13-11-24(30)12-14-29/h2-3,5-6,9-10,15,18,24,30H,4,7-8,11-14,16-17H2,1H3,(H,27,31)(H,28,32)/t18-/m1/s1 |
| InChIKey | ATLCTUDDXKFKFS-GOSISDBHSA-N |
| XLogP | 2.63 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|